About acetyl 4-methyl-5-sulfanylhexanoate
acetyl 4-methyl-5-sulfanylhexanoate (PubChem CID 174588595) has the molecular formula C9H16O3S
and a molecular weight of 204.29 g/mol. Its IUPAC name is acetyl 4-methyl-5-sulfanylhexanoate.
Molecular Properties
| Compound Name | acetyl 4-methyl-5-sulfanylhexanoate |
| PubChem CID | 174588595 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | acetyl 4-methyl-5-sulfanylhexanoate |
| SMILES | CC(=O)OC(=O)CCC(C)C(C)S |
| InChI | InChI=1S/C9H16O3S/c1-6(7(2)13)4-5-9(11)12-8(3)10/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | LLLHRBPSLGKZMN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acetyl 4-methyl-5-sulfanylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 4-methyl-5-sulfanylhexanoate?
The IUPAC name of acetyl 4-methyl-5-sulfanylhexanoate (CID 174588595) is acetyl 4-methyl-5-sulfanylhexanoate.
What is the SMILES notation for acetyl 4-methyl-5-sulfanylhexanoate?
The canonical SMILES for acetyl 4-methyl-5-sulfanylhexanoate is CC(=O)OC(=O)CCC(C)C(C)S.
What is the InChIKey of acetyl 4-methyl-5-sulfanylhexanoate?
The InChIKey is LLLHRBPSLGKZMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S/c1-6(7(2)13)4-5-9(11)12-8(3)10/h6-7,13H,4-5H2,1-3H3.
What are the key properties of acetyl 4-methyl-5-sulfanylhexanoate?
acetyl 4-methyl-5-sulfanylhexanoate has a molecular weight of 204.29 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 4-methyl-5-sulfanylhexanoate is sourced from PubChem (CID 174588595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).