C9H16O3S — CID 174588605
acetyl (4S,5S)-4-methyl-5-sulfanylhexanoate (PubChem CID 174588605) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is acetyl (4S,5S)-4-methyl-5-sulfanylhexanoate.
| Compound Name | acetyl (4S,5S)-4-methyl-5-sulfanylhexanoate |
|---|---|
| PubChem CID | 174588605 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | acetyl (4S,5S)-4-methyl-5-sulfanylhexanoate |
| SMILES | CC(=O)OC(=O)CC[C@H](C)[C@H](C)S |
| InChI | InChI=1S/C9H16O3S/c1-6(7(2)13)4-5-9(11)12-8(3)10/h6-7,13H,4-5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | LLLHRBPSLGKZMN-BQBZGAKWSA-N |
| XLogP | 1.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|