C20H29N3O2 — CID 174590200
3-[4-[(5R)-4-imino-5-methylheptoxy]phenyl]-5,5-dimethyl-1,4-dihydropyridazin-6-one (PubChem CID 174590200) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-[4-[(5R)-4-imino-5-methylheptoxy]phenyl]-5,5-dimethyl-1,4-dihydropyridazin-6-one.
| Compound Name | 3-[4-[(5R)-4-imino-5-methylheptoxy]phenyl]-5,5-dimethyl-1,4-dihydropyridazin-6-one |
|---|---|
| PubChem CID | 174590200 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-[4-[(5R)-4-imino-5-methylheptoxy]phenyl]-5,5-dimethyl-1,4-dihydropyridazin-6-one |
| SMILES | [H]/N=C(/CCCOc1ccc(C2=NNC(=O)C(C)(C)C2)cc1)[C@H](C)CC |
| InChI | InChI=1S/C20H29N3O2/c1-5-14(2)17(21)7-6-12-25-16-10-8-15(9-11-16)18-13-20(3,4)19(24)23-22-18/h8-11,14,21H,5-7,12-13H2,1-4H3,(H,23,24)/b21-17-/t14-/m1/s1 |
| InChIKey | WICDFPOSAAEVTP-GICLCMKGSA-N |
| XLogP | 4.16 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|