C23H19ClN4O2 — CID 174591274
N-[4-(aminomethyl)-3-(7-chloro-1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide (PubChem CID 174591274) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is N-[4-(aminomethyl)-3-(7-chloro-1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide.
| Compound Name | N-[4-(aminomethyl)-3-(7-chloro-1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 174591274 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[4-(aminomethyl)-3-(7-chloro-1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide |
| SMILES | Cn1c(=O)c(-c2cc(NC(=O)c3ccccc3)ccc2CN)cc2cnc(Cl)cc21 |
| InChI | InChI=1S/C23H19ClN4O2/c1-28-20-11-21(24)26-13-16(20)9-19(23(28)30)18-10-17(8-7-15(18)12-25)27-22(29)14-5-3-2-4-6-14/h2-11,13H,12,25H2,1H3,(H,27,29) |
| InChIKey | UVFJNIANYFHZNI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|