C22H15Cl2N3O2 — CID 59833886
N-[2,4-dichloro-3-(1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide (PubChem CID 59833886) has the molecular formula C22H15Cl2N3O2 and a molecular weight of 424.29 g/mol. Its IUPAC name is N-[2,4-dichloro-3-(1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide.
| Compound Name | N-[2,4-dichloro-3-(1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 59833886 |
| Molecular Formula | C22H15Cl2N3O2 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N-[2,4-dichloro-3-(1-methyl-2-oxo-1,6-naphthyridin-3-yl)phenyl]benzamide |
| SMILES | Cn1c(=O)c(-c2c(Cl)ccc(NC(=O)c3ccccc3)c2Cl)cc2cnccc21 |
| InChI | InChI=1S/C22H15Cl2N3O2/c1-27-18-9-10-25-12-14(18)11-15(22(27)29)19-16(23)7-8-17(20(19)24)26-21(28)13-5-3-2-4-6-13/h2-12H,1H3,(H,26,28) |
| InChIKey | SYTXERXNZCFTBD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |