About 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine
2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine (PubChem CID 174591909) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine.
Molecular Properties
| Compound Name | 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine |
| PubChem CID | 174591909 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine |
| SMILES | COc1nc2ccccc2c(C=O)c1OC.NN |
| InChI | InChI=1S/C12H11NO3.H4N2/c1-15-11-9(7-14)8-5-3-4-6-10(8)13-12(11)16-2;1-2/h3-7H,1-2H3;1-2H2 |
| InChIKey | HDARBEWUVQUNTL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine?
The IUPAC name of 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine (CID 174591909) is 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine.
What is the SMILES notation for 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine?
The canonical SMILES for 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine is COc1nc2ccccc2c(C=O)c1OC.NN.
What is the InChIKey of 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine?
The InChIKey is HDARBEWUVQUNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3.H4N2/c1-15-11-9(7-14)8-5-3-4-6-10(8)13-12(11)16-2;1-2/h3-7H,1-2H3;1-2H2.
What are the key properties of 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine?
2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine has a molecular weight of 249.27 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxyquinoline-4-carbaldehyde;hydrazine is sourced from PubChem (CID 174591909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).