C19H29N5O4 — CID 174592453
(4S)-2-amino-4-[3-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoylamino]-3-oxo-5-phenylpentanamide (PubChem CID 174592453) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (4S)-2-amino-4-[3-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoylamino]-3-oxo-5-phenylpentanamide.
| Compound Name | (4S)-2-amino-4-[3-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoylamino]-3-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 174592453 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | (4S)-2-amino-4-[3-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoylamino]-3-oxo-5-phenylpentanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCCC(=O)N[C@@H](Cc1ccccc1)C(=O)C(N)C(N)=O |
| InChI | InChI=1S/C19H29N5O4/c1-11(2)15(20)19(28)23-9-8-14(25)24-13(17(26)16(21)18(22)27)10-12-6-4-3-5-7-12/h3-7,11,13,15-16H,8-10,20-21H2,1-2H3,(H2,22,27)(H,23,28)(H,24,25)/t13-,15-,16?/m0/s1 |
| InChIKey | VARKIDKVYHEYDJ-JFXOEICMSA-N |
| XLogP | -1.41 |
| TPSA | 170.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|