C21H32N6O4 — CID 174592469
6-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexanoic acid (PubChem CID 174592469) has the molecular formula C21H32N6O4 and a molecular weight of 432.53 g/mol. Its IUPAC name is 6-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexanoic acid.
| Compound Name | 6-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 174592469 |
| Molecular Formula | C21H32N6O4 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 6-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]hexanoic acid |
| SMILES | CC(=O)N1CCN(c2nc(NCCCCCC(=O)O)c3c(n2)C(=O)N(C(C)C)C3)CC1 |
| InChI | InChI=1S/C21H32N6O4/c1-14(2)27-13-16-18(20(27)31)23-21(26-11-9-25(10-12-26)15(3)28)24-19(16)22-8-6-4-5-7-17(29)30/h14H,4-13H2,1-3H3,(H,29,30)(H,22,23,24) |
| InChIKey | UPBQWYPQZWTRGT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|