C21H32N6O4 — CID 57499989
ethyl 4-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]butanoate (PubChem CID 57499989) has the molecular formula C21H32N6O4 and a molecular weight of 432.53 g/mol. Its IUPAC name is ethyl 4-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 57499989 |
| Molecular Formula | C21H32N6O4 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | ethyl 4-[[2-(4-acetylpiperazin-1-yl)-7-oxo-6-propan-2-yl-5H-pyrrolo[3,4-d]pyrimidin-4-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(N2CCN(C(C)=O)CC2)nc2c1CN(C(C)C)C2=O |
| InChI | InChI=1S/C21H32N6O4/c1-5-31-17(29)7-6-8-22-19-16-13-27(14(2)3)20(30)18(16)23-21(24-19)26-11-9-25(10-12-26)15(4)28/h14H,5-13H2,1-4H3,(H,22,23,24) |
| InChIKey | BFWQKEGBMCBKDA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|