C18H18FN3O2 — CID 174592632
2-[3-(aminomethyl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 174592632) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 2-[3-(aminomethyl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 174592632 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-1-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | NCc1cccc(C2CC2(C(N)=O)C(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FN3O2/c19-13-4-6-14(7-5-13)22-17(24)18(16(21)23)9-15(18)12-3-1-2-11(8-12)10-20/h1-8,15H,9-10,20H2,(H2,21,23)(H,22,24) |
| InChIKey | ARFBWOYLROMEQI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|