C20H23ClN2O2 — CID 174594171
1-(4-chlorophenyl)-4-[4-[(3-methyloxiran-2-yl)methoxy]phenyl]piperazine (PubChem CID 174594171) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[4-[(3-methyloxiran-2-yl)methoxy]phenyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-[4-[(3-methyloxiran-2-yl)methoxy]phenyl]piperazine |
|---|---|
| PubChem CID | 174594171 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[4-[(3-methyloxiran-2-yl)methoxy]phenyl]piperazine |
| SMILES | CC1OC1COc1ccc(N2CCN(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-15-20(25-15)14-24-19-8-6-18(7-9-19)23-12-10-22(11-13-23)17-4-2-16(21)3-5-17/h2-9,15,20H,10-14H2,1H3 |
| InChIKey | ALRAFTSGMWAYRR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|