C9H12N2O3S — CID 174594215
(4-hydroxy-3-methoxyphenyl)methylsulfanylurea (PubChem CID 174594215) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is (4-hydroxy-3-methoxyphenyl)methylsulfanylurea.
| Compound Name | (4-hydroxy-3-methoxyphenyl)methylsulfanylurea |
|---|---|
| PubChem CID | 174594215 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (4-hydroxy-3-methoxyphenyl)methylsulfanylurea |
| SMILES | COc1cc(CSNC(N)=O)ccc1O |
| InChI | InChI=1S/C9H12N2O3S/c1-14-8-4-6(2-3-7(8)12)5-15-11-9(10)13/h2-4,12H,5H2,1H3,(H3,10,11,13) |
| InChIKey | CKTTXZHCPZDQSE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|