C3Br4Cl4 — CID 174595254
1,1,2,2-tetrabromoethene;tetrachloromethane (PubChem CID 174595254) has the molecular formula C3Br4Cl4 and a molecular weight of 497.46 g/mol. Its IUPAC name is 1,1,2,2-tetrabromoethene;tetrachloromethane.
| Compound Name | 1,1,2,2-tetrabromoethene;tetrachloromethane |
|---|---|
| PubChem CID | 174595254 |
| Molecular Formula | C3Br4Cl4 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 491.55 |
| IUPAC Name | 1,1,2,2-tetrabromoethene;tetrachloromethane |
| SMILES | BrC(Br)=C(Br)Br.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C2Br4.CCl4/c3-1(4)2(5)6;2-1(3,4)5 |
| InChIKey | MLZKPEAUZIRXRB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|