C22H26F3N3O4 — CID 174595683
1-(2,4-dimethyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione;ethyl formate (PubChem CID 174595683) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione;ethyl formate.
| Compound Name | 1-(2,4-dimethyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione;ethyl formate |
|---|---|
| PubChem CID | 174595683 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-(2,4-dimethyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione;ethyl formate |
| SMILES | CCOC=O.Cc1c[nH]c(C)c1C(=O)C(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H20F3N3O2.C3H6O2/c1-12-11-23-13(2)16(12)17(26)18(27)25-8-6-24(7-9-25)15-5-3-4-14(10-15)19(20,21)22;1-2-5-3-4/h3-5,10-11,23H,6-9H2,1-2H3;3H,2H2,1H3 |
| InChIKey | PGAUEKTVFNFLRB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|