C23H20F3N3O2 — CID 141222165
1-(5-phenyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 141222165) has the molecular formula C23H20F3N3O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 1-(5-phenyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(5-phenyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 141222165 |
| Molecular Formula | C23H20F3N3O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-(5-phenyl-1H-pyrrol-3-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1c[nH]c(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H20F3N3O2/c24-23(25,26)18-7-4-8-19(14-18)28-9-11-29(12-10-28)22(31)21(30)17-13-20(27-15-17)16-5-2-1-3-6-16/h1-8,13-15,27H,9-12H2 |
| InChIKey | XWSILNGIIIJETJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|