C21H19F3N4O3 — CID 18408816
5-phenyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 18408816) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is 5-phenyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-phenyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18408816 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-phenyl-5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(c2ccccc2)(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C21H19F3N4O3/c22-21(23,24)15-7-4-8-16(13-15)27-9-11-28(12-10-27)20(14-5-2-1-3-6-14)17(29)25-19(31)26-18(20)30/h1-8,13H,9-12H2,(H2,25,26,29,30,31) |
| InChIKey | MBAOCTDOYGCHKJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|