C26H21F3N2O2 — CID 15990234
2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]indene-1,3-dione (PubChem CID 15990234) has the molecular formula C26H21F3N2O2 and a molecular weight of 450.46 g/mol. Its IUPAC name is 2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]indene-1,3-dione.
| Compound Name | 2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 15990234 |
| Molecular Formula | C26H21F3N2O2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1(c1ccccc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H21F3N2O2/c27-26(28,29)19-9-6-10-20(17-19)30-13-15-31(16-14-30)25(18-7-2-1-3-8-18)23(32)21-11-4-5-12-22(21)24(25)33/h1-12,17H,13-16H2 |
| InChIKey | HDEKXLMZXVMBAS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|