C17H12ClF3N4O2S — CID 14350497
5-chloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-2,1,3-benzothiadiazole-4,7-dione (PubChem CID 14350497) has the molecular formula C17H12ClF3N4O2S and a molecular weight of 428.82 g/mol. Its IUPAC name is 5-chloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-2,1,3-benzothiadiazole-4,7-dione.
| Compound Name | 5-chloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-2,1,3-benzothiadiazole-4,7-dione |
|---|---|
| PubChem CID | 14350497 |
| Molecular Formula | C17H12ClF3N4O2S |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 5-chloro-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-2,1,3-benzothiadiazole-4,7-dione |
| SMILES | O=C1C(Cl)=C(N2CCN(c3cccc(C(F)(F)F)c3)CC2)C(=O)c2nsnc21 |
| InChI | InChI=1S/C17H12ClF3N4O2S/c18-11-14(16(27)13-12(15(11)26)22-28-23-13)25-6-4-24(5-7-25)10-3-1-2-9(8-10)17(19,20)21/h1-3,8H,4-7H2 |
| InChIKey | CWRJRFIBRUEMNS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|