C22H19F3N2OS — CID 24513867
(3-phenylthiophen-2-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 24513867) has the molecular formula C22H19F3N2OS and a molecular weight of 416.47 g/mol. Its IUPAC name is (3-phenylthiophen-2-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (3-phenylthiophen-2-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24513867 |
| Molecular Formula | C22H19F3N2OS |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (3-phenylthiophen-2-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1sccc1-c1ccccc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H19F3N2OS/c23-22(24,25)17-7-4-8-18(15-17)26-10-12-27(13-11-26)21(28)20-19(9-14-29-20)16-5-2-1-3-6-16/h1-9,14-15H,10-13H2 |
| InChIKey | ULERULRERTVCSS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |