C16H17F3N4OS — CID 34829975
(4-ethylthiadiazol-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 34829975) has the molecular formula C16H17F3N4OS and a molecular weight of 370.40 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (4-ethylthiadiazol-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 34829975 |
| Molecular Formula | C16H17F3N4OS |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CCc1nnsc1C(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H17F3N4OS/c1-2-13-14(25-21-20-13)15(24)23-8-6-22(7-9-23)12-5-3-4-11(10-12)16(17,18)19/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | PZVHAYADUVUVAK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |