C27H43N3O2 — CID 174597039
4-[4-[[[4-(cyclohexylmethyl)cyclohexyl]methylamino]methyl]piperidin-1-yl]-N-hydroxybenzamide (PubChem CID 174597039) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is 4-[4-[[[4-(cyclohexylmethyl)cyclohexyl]methylamino]methyl]piperidin-1-yl]-N-hydroxybenzamide.
| Compound Name | 4-[4-[[[4-(cyclohexylmethyl)cyclohexyl]methylamino]methyl]piperidin-1-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 174597039 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | 4-[4-[[[4-(cyclohexylmethyl)cyclohexyl]methylamino]methyl]piperidin-1-yl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(N2CCC(CNCC3CCC(CC4CCCCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H43N3O2/c31-27(29-32)25-10-12-26(13-11-25)30-16-14-24(15-17-30)20-28-19-23-8-6-22(7-9-23)18-21-4-2-1-3-5-21/h10-13,21-24,28,32H,1-9,14-20H2,(H,29,31) |
| InChIKey | OBXORWNTIVEYGG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|