C10H21N3O3 — CID 174598026
2-aminopropanamide;1-(dimethylamino)ethyl prop-2-enoate (PubChem CID 174598026) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-aminopropanamide;1-(dimethylamino)ethyl prop-2-enoate.
| Compound Name | 2-aminopropanamide;1-(dimethylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 174598026 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-aminopropanamide;1-(dimethylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)N(C)C.CC(N)C(N)=O |
| InChI | InChI=1S/C7H13NO2.C3H8N2O/c1-5-7(9)10-6(2)8(3)4;1-2(4)3(5)6/h5-6H,1H2,2-4H3;2H,4H2,1H3,(H2,5,6) |
| InChIKey | DTPRCLDYYVHRQJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|