About 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid
1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid (PubChem CID 174330894) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid |
| PubChem CID | 174330894 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid |
| SMILES | C=CC(=O)OC(C)N(C)C.CNCC(=O)O |
| InChI | InChI=1S/C7H13NO2.C3H7NO2/c1-5-7(9)10-6(2)8(3)4;1-4-2-3(5)6/h5-6H,1H2,2-4H3;4H,2H2,1H3,(H,5,6) |
| InChIKey | QPSWXCWPOYNYJN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid?
The IUPAC name of 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid (CID 174330894) is 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid.
What is the SMILES notation for 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid?
The canonical SMILES for 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid is C=CC(=O)OC(C)N(C)C.CNCC(=O)O.
What is the InChIKey of 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid?
The InChIKey is QPSWXCWPOYNYJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C3H7NO2/c1-5-7(9)10-6(2)8(3)4;1-4-2-3(5)6/h5-6H,1H2,2-4H3;4H,2H2,1H3,(H,5,6).
What are the key properties of 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid?
1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid has a molecular weight of 232.28 g/mol, XLogP of -0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl prop-2-enoate;2-(methylamino)acetic acid is sourced from PubChem (CID 174330894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).