C12H16Cl2N2 — CID 174599012
1-N'-naphthalen-1-ylethane-1,1-diamine;dihydrochloride (PubChem CID 174599012) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is 1-N'-naphthalen-1-ylethane-1,1-diamine;dihydrochloride.
| Compound Name | 1-N'-naphthalen-1-ylethane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 174599012 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-N'-naphthalen-1-ylethane-1,1-diamine;dihydrochloride |
| SMILES | CC(N)Nc1cccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C12H14N2.2ClH/c1-9(13)14-12-8-4-6-10-5-2-3-7-11(10)12;;/h2-9,14H,13H2,1H3;2*1H |
| InChIKey | DBSBFBRLUSKQMJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|