C10H7ClN2O3 — CID 174599084
5-(2-chlorobenzoyl)imidazolidine-2,4-dione (PubChem CID 174599084) has the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. Its IUPAC name is 5-(2-chlorobenzoyl)imidazolidine-2,4-dione.
| Compound Name | 5-(2-chlorobenzoyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174599084 |
| Molecular Formula | C10H7ClN2O3 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 5-(2-chlorobenzoyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C(=O)c2ccccc2Cl)N1 |
| InChI | InChI=1S/C10H7ClN2O3/c11-6-4-2-1-3-5(6)8(14)7-9(15)13-10(16)12-7/h1-4,7H,(H2,12,13,15,16) |
| InChIKey | OCAJRSBELBDBBT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|