C11H7ClN2O2 — CID 143512660
5-[2-(2-chlorophenyl)ethynyl]imidazolidine-2,4-dione (PubChem CID 143512660) has the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-(2-chlorophenyl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143512660 |
| Molecular Formula | C11H7ClN2O2 |
| Molecular Weight | 234.64 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 5-[2-(2-chlorophenyl)ethynyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C#Cc2ccccc2Cl)N1 |
| InChI | InChI=1S/C11H7ClN2O2/c12-8-4-2-1-3-7(8)5-6-9-10(15)14-11(16)13-9/h1-4,9H,(H2,13,14,15,16) |
| InChIKey | WSNPYBGXELAFQH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.64 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|