C11H8ClNO2 — CID 102522223
3-[2-(2-chlorophenyl)ethynyl]-1,3-oxazolidin-2-one (PubChem CID 102522223) has the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethynyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(2-chlorophenyl)ethynyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102522223 |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethynyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1C#Cc1ccccc1Cl |
| InChI | InChI=1S/C11H8ClNO2/c12-10-4-2-1-3-9(10)5-6-13-7-8-15-11(13)14/h1-4H,7-8H2 |
| InChIKey | PLLOQNPDUIGIFP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|