C12H11NO3 — CID 102450789
3-[2-(3-methoxyphenyl)ethynyl]-1,3-oxazolidin-2-one (PubChem CID 102450789) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-[2-(3-methoxyphenyl)ethynyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(3-methoxyphenyl)ethynyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102450789 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-[2-(3-methoxyphenyl)ethynyl]-1,3-oxazolidin-2-one |
| SMILES | COc1cccc(C#CN2CCOC2=O)c1 |
| InChI | InChI=1S/C12H11NO3/c1-15-11-4-2-3-10(9-11)5-6-13-7-8-16-12(13)14/h2-4,9H,7-8H2,1H3 |
| InChIKey | GOQIUDKLSZJURC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|