C9H7Cl2NO2 — CID 14120198
3-(2,6-dichlorophenyl)-1,3-oxazolidin-2-one (PubChem CID 14120198) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2,6-dichlorophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14120198 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H7Cl2NO2/c10-6-2-1-3-7(11)8(6)12-4-5-14-9(12)13/h1-3H,4-5H2 |
| InChIKey | OOGGKUOMJVAGBR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |