C9H8ClNO3 — CID 58394005
3-(3-chloro-4-hydroxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 58394005) has the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. Its IUPAC name is 3-(3-chloro-4-hydroxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(3-chloro-4-hydroxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58394005 |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3-(3-chloro-4-hydroxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClNO3/c10-7-5-6(1-2-8(7)12)11-3-4-14-9(11)13/h1-2,5,12H,3-4H2 |
| InChIKey | LRQVCHXIDSEBTC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |