C15H14ClN2O5P — CID 139616432
3,4-bis(2-oxo-1,3-oxazolidin-3-yl)-1H-phosphonine-2-carbonyl chloride (PubChem CID 139616432) has the molecular formula C15H14ClN2O5P and a molecular weight of 368.71 g/mol. Its IUPAC name is 3,4-bis(2-oxo-1,3-oxazolidin-3-yl)-1H-phosphonine-2-carbonyl chloride.
| Compound Name | 3,4-bis(2-oxo-1,3-oxazolidin-3-yl)-1H-phosphonine-2-carbonyl chloride |
|---|---|
| PubChem CID | 139616432 |
| Molecular Formula | C15H14ClN2O5P |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 3,4-bis(2-oxo-1,3-oxazolidin-3-yl)-1H-phosphonine-2-carbonyl chloride |
| SMILES | O=C(Cl)c1[pH]cccccc(N2CCOC2=O)c1N1CCOC1=O |
| InChI | InChI=1S/C15H14ClN2O5P/c16-13(19)12-11(18-6-8-23-15(18)21)10(4-2-1-3-9-24-12)17-5-7-22-14(17)20/h1-4,9,24H,5-8H2/b2-1-,9-3-,10-4+,12-11+ |
| InChIKey | QBDWYLAACWNXRU-QXICKBDOSA-N |
| XLogP | 3.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|