C13H17NO2 — CID 14120196
3-(2,6-diethylphenyl)-1,3-oxazolidin-2-one (PubChem CID 14120196) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(2,6-diethylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2,6-diethylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14120196 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(2,6-diethylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CCc1cccc(CC)c1N1CCOC1=O |
| InChI | InChI=1S/C13H17NO2/c1-3-10-6-5-7-11(4-2)12(10)14-8-9-16-13(14)15/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | GFQDDVNKKJZFFE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |