C10H11Cl2N2O3+ — CID 144841807
[3,5-dichloro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-methoxyazanium (PubChem CID 144841807) has the molecular formula C10H11Cl2N2O3+ and a molecular weight of 278.11 g/mol. Its IUPAC name is [3,5-dichloro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-methoxyazanium.
| Compound Name | [3,5-dichloro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-methoxyazanium |
|---|---|
| PubChem CID | 144841807 |
| Molecular Formula | C10H11Cl2N2O3+ |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | [3,5-dichloro-4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-methoxyazanium |
| SMILES | CO[NH2+]c1cc(Cl)c(N2CCOC2=O)c(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2O3/c1-16-13-6-4-7(11)9(8(12)5-6)14-2-3-17-10(14)15/h4-5,13H,2-3H2,1H3/p+1 |
| InChIKey | DWBDZLJBZDZMBC-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|