C13H11N3O3 — CID 143990882
3-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-4-methylbenzamide (PubChem CID 143990882) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-4-methylbenzamide.
| Compound Name | 3-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143990882 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)cc1C#CC1NC(=O)NC1=O |
| InChI | InChI=1S/C13H11N3O3/c1-7-2-3-9(11(14)17)6-8(7)4-5-10-12(18)16-13(19)15-10/h2-3,6,10H,1H3,(H2,14,17)(H2,15,16,18,19) |
| InChIKey | TVTSIUYBPUWNGZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|