C23H24N4O5 — CID 143991342
2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetamide;5-methoxy-N,2-dimethylbenzamide (PubChem CID 143991342) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetamide;5-methoxy-N,2-dimethylbenzamide.
| Compound Name | 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetamide;5-methoxy-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 143991342 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetamide;5-methoxy-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(OC)ccc1C.NC(=O)Cc1ccc(C#CC2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C13H11N3O3.C10H13NO2/c14-11(17)7-9-3-1-8(2-4-9)5-6-10-12(18)16-13(19)15-10;1-7-4-5-8(13-3)6-9(7)10(12)11-2/h1-4,10H,7H2,(H2,14,17)(H2,15,16,18,19);4-6H,1-3H3,(H,11,12) |
| InChIKey | QLDQTVYTTFPUHO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|