C28H34N4O4 — CID 143990887
N-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]-N'-ethenyl-N-methylmethanimidamide;ethane;1-(2-ethyl-5-methoxyphenyl)ethanone (PubChem CID 143990887) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]-N'-ethenyl-N-methylmethanimidamide;ethane;1-(2-ethyl-5-methoxyphenyl)ethanone.
| Compound Name | N-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]-N'-ethenyl-N-methylmethanimidamide;ethane;1-(2-ethyl-5-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 143990887 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]-N'-ethenyl-N-methylmethanimidamide;ethane;1-(2-ethyl-5-methoxyphenyl)ethanone |
| SMILES | C=C/N=C/N(C)c1ccc(C#CC2NC(=O)NC2=O)cc1.CC.CCc1ccc(OC)cc1C(C)=O |
| InChI | InChI=1S/C15H14N4O2.C11H14O2.C2H6/c1-3-16-10-19(2)12-7-4-11(5-8-12)6-9-13-14(20)18-15(21)17-13;1-4-9-5-6-10(13-3)7-11(9)8(2)12;1-2/h3-5,7-8,10,13H,1H2,2H3,(H2,17,18,20,21);5-7H,4H2,1-3H3;1-2H3/b16-10+;; |
| InChIKey | VINILVRFETUNCK-CNSDMJOKSA-N |
| XLogP | 4.34 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|