C24H23N3O6 — CID 143991222
6-methoxy-2-methyl-3H-isoindol-1-one;methyl 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetate (PubChem CID 143991222) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3H-isoindol-1-one;methyl 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetate.
| Compound Name | 6-methoxy-2-methyl-3H-isoindol-1-one;methyl 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetate |
|---|---|
| PubChem CID | 143991222 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 6-methoxy-2-methyl-3H-isoindol-1-one;methyl 2-[4-[2-(2,5-dioxoimidazolidin-4-yl)ethynyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(C#CC2NC(=O)NC2=O)cc1.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C14H12N2O4.C10H11NO2/c1-20-12(17)8-10-4-2-9(3-5-10)6-7-11-13(18)16-14(19)15-11;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h2-5,11H,8H2,1H3,(H2,15,16,18,19);3-5H,6H2,1-2H3 |
| InChIKey | IXIWQQSUMGARLH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|