C28H31N5O4 — CID 143990866
6-methoxy-2-methyl-3H-isoindol-1-one;5-[(3Z,5Z)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethenyl]hepta-3,5-dien-1-ynyl]imidazolidine-2,4-dione (PubChem CID 143990866) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3H-isoindol-1-one;5-[(3Z,5Z)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethenyl]hepta-3,5-dien-1-ynyl]imidazolidine-2,4-dione.
| Compound Name | 6-methoxy-2-methyl-3H-isoindol-1-one;5-[(3Z,5Z)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethenyl]hepta-3,5-dien-1-ynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143990866 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 6-methoxy-2-methyl-3H-isoindol-1-one;5-[(3Z,5Z)-3-[1-(1,3,5-trimethylpyrazol-4-yl)ethenyl]hepta-3,5-dien-1-ynyl]imidazolidine-2,4-dione |
| SMILES | C=C(/C(C#CC1NC(=O)NC1=O)=C\C=C/C)c1c(C)nn(C)c1C.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C18H20N4O2.C10H11NO2/c1-6-7-8-14(9-10-15-17(23)20-18(24)19-15)11(2)16-12(3)21-22(5)13(16)4;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h6-8,15H,2H2,1,3-5H3,(H2,19,20,23,24);3-5H,6H2,1-2H3/b7-6-,14-8-; |
| InChIKey | VZTMDXIXBHQESL-REDQGZETSA-N |
| XLogP | 3.04 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|