C23H25FN4O3 — CID 143512652
2-amino-4-[(3E,5E)-3-ethenyl-5-fluoro-4-methylhepta-3,5-dien-1-ynyl]-1,4-dihydroimidazol-5-one;6-methoxy-2-methyl-3H-isoindol-1-one (PubChem CID 143512652) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-amino-4-[(3E,5E)-3-ethenyl-5-fluoro-4-methylhepta-3,5-dien-1-ynyl]-1,4-dihydroimidazol-5-one;6-methoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | 2-amino-4-[(3E,5E)-3-ethenyl-5-fluoro-4-methylhepta-3,5-dien-1-ynyl]-1,4-dihydroimidazol-5-one;6-methoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143512652 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-amino-4-[(3E,5E)-3-ethenyl-5-fluoro-4-methylhepta-3,5-dien-1-ynyl]-1,4-dihydroimidazol-5-one;6-methoxy-2-methyl-3H-isoindol-1-one |
| SMILES | C=C/C(C#CC1N=C(N)NC1=O)=C(C)\C(F)=C/C.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C13H14FN3O.C10H11NO2/c1-4-9(8(3)10(14)5-2)6-7-11-12(18)17-13(15)16-11;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h4-5,11H,1H2,2-3H3,(H3,15,16,17,18);3-5H,6H2,1-2H3/b9-8+,10-5+; |
| InChIKey | XOZIXODCCMBFFA-ZKVHLEAOSA-N |
| XLogP | 2.46 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|