C25H28N4O6 — CID 143990138
ethane;5-[6-(1-methoxyethenyl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one (PubChem CID 143990138) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is ethane;5-[6-(1-methoxyethenyl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | ethane;5-[6-(1-methoxyethenyl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143990138 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | ethane;5-[6-(1-methoxyethenyl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
| SMILES | C=C(OC)c1cnc2cc(C3NC(=O)NC3=O)oc2c1.CC.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C13H11N3O4.C10H11NO2.C2H6/c1-6(19-2)7-3-9-8(14-5-7)4-10(20-9)11-12(17)16-13(18)15-11;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12;1-2/h3-5,11H,1H2,2H3,(H2,15,16,17,18);3-5H,6H2,1-2H3;1-2H3 |
| InChIKey | KRFPPJQWHGKHMY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|