C28H35N7O6 — CID 143989476
5-[6-[(4-ethylpiperazin-1-yl)-(hydroxyamino)methyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;7-methoxy-2-methyl-3,4-dihydroisoquinolin-1-one (PubChem CID 143989476) has the molecular formula C28H35N7O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is 5-[6-[(4-ethylpiperazin-1-yl)-(hydroxyamino)methyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;7-methoxy-2-methyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 5-[6-[(4-ethylpiperazin-1-yl)-(hydroxyamino)methyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;7-methoxy-2-methyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 143989476 |
| Molecular Formula | C28H35N7O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 5-[6-[(4-ethylpiperazin-1-yl)-(hydroxyamino)methyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;7-methoxy-2-methyl-3,4-dihydroisoquinolin-1-one |
| SMILES | CCN1CCN(C(NO)c2cnc3cc(C4NC(=O)NC4=O)oc3c2)CC1.COc1ccc2c(c1)C(=O)N(C)CC2 |
| InChI | InChI=1S/C17H22N6O4.C11H13NO2/c1-2-22-3-5-23(6-4-22)15(21-26)10-7-12-11(18-9-10)8-13(27-12)14-16(24)20-17(25)19-14;1-12-6-5-8-3-4-9(14-2)7-10(8)11(12)13/h7-9,14-15,21,26H,2-6H2,1H3,(H2,19,20,24,25);3-4,7H,5-6H2,1-2H3 |
| InChIKey | SJLCBASMXZLAGP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 152.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|