C29H32N6O6 — CID 143990114
5-[5-[2-hydroxyethyl-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]amino]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one (PubChem CID 143990114) has the molecular formula C29H32N6O6 and a molecular weight of 560.61 g/mol. Its IUPAC name is 5-[5-[2-hydroxyethyl-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]amino]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | 5-[5-[2-hydroxyethyl-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]amino]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143990114 |
| Molecular Formula | C29H32N6O6 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 5-[5-[2-hydroxyethyl-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]amino]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
| SMILES | C=N/C(=C\C=C/C)CN(CCO)c1ccc2oc(C3NC(=O)NC3=O)cc2n1.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C19H21N5O4.C10H11NO2/c1-3-4-5-12(20-2)11-24(8-9-25)16-7-6-14-13(21-16)10-15(28-14)17-18(26)23-19(27)22-17;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h3-7,10,17,25H,2,8-9,11H2,1H3,(H2,22,23,26,27);3-5H,6H2,1-2H3/b4-3-,12-5-; |
| InChIKey | QILFGCUBGVGZMK-BZPUIBSUSA-N |
| XLogP | 2.95 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|