C12H9N3O5 — CID 91386323
methyl 2-(2,5-dioxoimidazolidin-4-yl)furo[3,2-b]pyridine-5-carboxylate (PubChem CID 91386323) has the molecular formula C12H9N3O5 and a molecular weight of 275.22 g/mol. Its IUPAC name is methyl 2-(2,5-dioxoimidazolidin-4-yl)furo[3,2-b]pyridine-5-carboxylate.
| Compound Name | methyl 2-(2,5-dioxoimidazolidin-4-yl)furo[3,2-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 91386323 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | methyl 2-(2,5-dioxoimidazolidin-4-yl)furo[3,2-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1ccc2oc(C3NC(=O)NC3=O)cc2n1 |
| InChI | InChI=1S/C12H9N3O5/c1-19-11(17)5-2-3-7-6(13-5)4-8(20-7)9-10(16)15-12(18)14-9/h2-4,9H,1H3,(H2,14,15,16,18) |
| InChIKey | XIJTXWLNIBZDRD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|