C13H10N4O4 — CID 143989605
5-[5-(2-oxoazetidin-1-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione (PubChem CID 143989605) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is 5-[5-(2-oxoazetidin-1-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[5-(2-oxoazetidin-1-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143989605 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 5-[5-(2-oxoazetidin-1-yl)furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2cc3nc(N4CCC4=O)ccc3o2)N1 |
| InChI | InChI=1S/C13H10N4O4/c18-10-3-4-17(10)9-2-1-7-6(14-9)5-8(21-7)11-12(19)16-13(20)15-11/h1-2,5,11H,3-4H2,(H2,15,16,19,20) |
| InChIKey | XSNIZRQUOMGBFM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|