C28H32N6O5 — CID 143991500
5-[2-[4-[(Z)-C-(4-ethylpiperazin-1-yl)-N-hydroxycarbonimidoyl]phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one (PubChem CID 143991500) has the molecular formula C28H32N6O5 and a molecular weight of 532.60 g/mol. Its IUPAC name is 5-[2-[4-[(Z)-C-(4-ethylpiperazin-1-yl)-N-hydroxycarbonimidoyl]phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | 5-[2-[4-[(Z)-C-(4-ethylpiperazin-1-yl)-N-hydroxycarbonimidoyl]phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143991500 |
| Molecular Formula | C28H32N6O5 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 5-[2-[4-[(Z)-C-(4-ethylpiperazin-1-yl)-N-hydroxycarbonimidoyl]phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
| SMILES | CCN1CCN(/C(=N\O)c2ccc(C#CC3NC(=O)NC3=O)cc2)CC1.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C18H21N5O3.C10H11NO2/c1-2-22-9-11-23(12-10-22)16(21-26)14-6-3-13(4-7-14)5-8-15-17(24)20-18(25)19-15;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h3-4,6-7,15,26H,2,9-12H2,1H3,(H2,19,20,24,25);3-5H,6H2,1-2H3/b21-16-; |
| InChIKey | OVTRYMUSFWMPSQ-PLMZOXRSSA-N |
| XLogP | 1.30 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|