C27H23N3O5 — CID 143990846
(5S)-5-[2-[4-(2-hydroxyphenyl)phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one (PubChem CID 143990846) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is (5S)-5-[2-[4-(2-hydroxyphenyl)phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one.
| Compound Name | (5S)-5-[2-[4-(2-hydroxyphenyl)phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143990846 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (5S)-5-[2-[4-(2-hydroxyphenyl)phenyl]ethynyl]imidazolidine-2,4-dione;6-methoxy-2-methyl-3H-isoindol-1-one |
| SMILES | COc1ccc2c(c1)C(=O)N(C)C2.O=C1NC(=O)[C@H](C#Cc2ccc(-c3ccccc3O)cc2)N1 |
| InChI | InChI=1S/C17H12N2O3.C10H11NO2/c20-15-4-2-1-3-13(15)12-8-5-11(6-9-12)7-10-14-16(21)19-17(22)18-14;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h1-6,8-9,14,20H,(H2,18,19,21,22);3-5H,6H2,1-2H3/t14-;/m0./s1 |
| InChIKey | PSHFSJNCLNINJV-UQKRIMTDSA-N |
| XLogP | 2.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|