C21H23N5O4 — CID 143510664
6-methoxy-2-methyl-3H-isoindol-1-one;5-[(E)-2-[3-(methylamino)-2-pyridinyl]ethenyl]imidazolidine-2,4-dione (PubChem CID 143510664) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3H-isoindol-1-one;5-[(E)-2-[3-(methylamino)-2-pyridinyl]ethenyl]imidazolidine-2,4-dione.
| Compound Name | 6-methoxy-2-methyl-3H-isoindol-1-one;5-[(E)-2-[3-(methylamino)-2-pyridinyl]ethenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510664 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 6-methoxy-2-methyl-3H-isoindol-1-one;5-[(E)-2-[3-(methylamino)-2-pyridinyl]ethenyl]imidazolidine-2,4-dione |
| SMILES | CNc1cccnc1/C=C/C1NC(=O)NC1=O.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C11H12N4O2.C10H11NO2/c1-12-7-3-2-6-13-8(7)4-5-9-10(16)15-11(17)14-9;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h2-6,9,12H,1H3,(H2,14,15,16,17);3-5H,6H2,1-2H3/b5-4+; |
| InChIKey | SHZMDTVEOSMBDK-FXRZFVDSSA-N |
| XLogP | 1.63 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|