C9H7BrF4N2O2 — CID 174602109
2-[2-amino-4-bromo-6-(trifluoromethyl)anilino]-2-fluoroacetic acid (PubChem CID 174602109) has the molecular formula C9H7BrF4N2O2 and a molecular weight of 331.06 g/mol. Its IUPAC name is 2-[2-amino-4-bromo-6-(trifluoromethyl)anilino]-2-fluoroacetic acid.
| Compound Name | 2-[2-amino-4-bromo-6-(trifluoromethyl)anilino]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 174602109 |
| Molecular Formula | C9H7BrF4N2O2 |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 2-[2-amino-4-bromo-6-(trifluoromethyl)anilino]-2-fluoroacetic acid |
| SMILES | Nc1cc(Br)cc(C(F)(F)F)c1NC(F)C(=O)O |
| InChI | InChI=1S/C9H7BrF4N2O2/c10-3-1-4(9(12,13)14)6(5(15)2-3)16-7(11)8(17)18/h1-2,7,16H,15H2,(H,17,18) |
| InChIKey | BCUXXVRDGAPXCY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|