CH7N2O10P3 — CID 174604017
cyanamide;diphosphono hydrogen phosphate (PubChem CID 174604017) has the molecular formula CH7N2O10P3 and a molecular weight of 299.99 g/mol. Its IUPAC name is cyanamide;diphosphono hydrogen phosphate.
| Compound Name | cyanamide;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174604017 |
| Molecular Formula | CH7N2O10P3 |
| Molecular Weight | 299.99 g/mol |
| Exact Mass | 299.93 |
| IUPAC Name | cyanamide;diphosphono hydrogen phosphate |
| SMILES | N#CN.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/CH2N2.H5O10P3/c2-1-3;1-11(2,3)9-13(7,8)10-12(4,5)6/h2H2;(H,7,8)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | APCWLFQVXCJHDP-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 220.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.99 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|