C14H19BrFNO2 — CID 174605975
4-[(3-bromo-4-fluorophenyl)methylamino]-3,3-dimethylpentanoic acid (PubChem CID 174605975) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is 4-[(3-bromo-4-fluorophenyl)methylamino]-3,3-dimethylpentanoic acid.
| Compound Name | 4-[(3-bromo-4-fluorophenyl)methylamino]-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 174605975 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[(3-bromo-4-fluorophenyl)methylamino]-3,3-dimethylpentanoic acid |
| SMILES | CC(NCc1ccc(F)c(Br)c1)C(C)(C)CC(=O)O |
| InChI | InChI=1S/C14H19BrFNO2/c1-9(14(2,3)7-13(18)19)17-8-10-4-5-12(16)11(15)6-10/h4-6,9,17H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | HTUSLZUBDGVPHN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |